C13H15ClN4O2S — CID 168639496
6-[2-[(3-chloro-2-hydroxypropyl)amino]phenyl]-3-methylsulfanyl-4H-1,2,4-triazin-5-one (PubChem CID 168639496) has the molecular formula C13H15ClN4O2S and a molecular weight of 326.81 g/mol. Its IUPAC name is 6-[2-[(3-chloro-2-hydroxypropyl)amino]phenyl]-3-methylsulfanyl-4H-1,2,4-triazin-5-one.
| Compound Name | 6-[2-[(3-chloro-2-hydroxypropyl)amino]phenyl]-3-methylsulfanyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 168639496 |
| Molecular Formula | C13H15ClN4O2S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 6-[2-[(3-chloro-2-hydroxypropyl)amino]phenyl]-3-methylsulfanyl-4H-1,2,4-triazin-5-one |
| SMILES | CSc1nnc(-c2ccccc2NCC(O)CCl)c(=O)[nH]1 |
| InChI | InChI=1S/C13H15ClN4O2S/c1-21-13-16-12(20)11(17-18-13)9-4-2-3-5-10(9)15-7-8(19)6-14/h2-5,8,15,19H,6-7H2,1H3,(H,16,18,20) |
| InChIKey | GRCJNAZGDGQEIA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|