C12H27N2O4+ — CID 87835528
[1-(dimethylamino)-2,3-dihydroxypropyl]-bis(2-hydroxyethyl)-prop-2-enylazanium (PubChem CID 87835528) has the molecular formula C12H27N2O4+ and a molecular weight of 263.36 g/mol. Its IUPAC name is [1-(dimethylamino)-2,3-dihydroxypropyl]-bis(2-hydroxyethyl)-prop-2-enylazanium.
| Compound Name | [1-(dimethylamino)-2,3-dihydroxypropyl]-bis(2-hydroxyethyl)-prop-2-enylazanium |
|---|---|
| PubChem CID | 87835528 |
| Molecular Formula | C12H27N2O4+ |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | [1-(dimethylamino)-2,3-dihydroxypropyl]-bis(2-hydroxyethyl)-prop-2-enylazanium |
| SMILES | C=CC[N+](CCO)(CCO)C(C(O)CO)N(C)C |
| InChI | InChI=1S/C12H27N2O4/c1-4-5-14(6-8-15,7-9-16)12(13(2)3)11(18)10-17/h4,11-12,15-18H,1,5-10H2,2-3H3/q+1 |
| InChIKey | FOTYKHXVDVBATD-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|