C24H24F3N3O2 — CID 87835666
3-ethynyl-5-(2-oxopyrrolidin-1-yl)-2-propyl-4-[(2,2,2-trifluoro-1-phenylethyl)amino]benzamide (PubChem CID 87835666) has the molecular formula C24H24F3N3O2 and a molecular weight of 443.47 g/mol. Its IUPAC name is 3-ethynyl-5-(2-oxopyrrolidin-1-yl)-2-propyl-4-[(2,2,2-trifluoro-1-phenylethyl)amino]benzamide.
| Compound Name | 3-ethynyl-5-(2-oxopyrrolidin-1-yl)-2-propyl-4-[(2,2,2-trifluoro-1-phenylethyl)amino]benzamide |
|---|---|
| PubChem CID | 87835666 |
| Molecular Formula | C24H24F3N3O2 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 3-ethynyl-5-(2-oxopyrrolidin-1-yl)-2-propyl-4-[(2,2,2-trifluoro-1-phenylethyl)amino]benzamide |
| SMILES | C#Cc1c(CCC)c(C(N)=O)cc(N2CCCC2=O)c1NC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H24F3N3O2/c1-3-9-17-16(4-2)21(29-22(24(25,26)27)15-10-6-5-7-11-15)19(14-18(17)23(28)32)30-13-8-12-20(30)31/h2,5-7,10-11,14,22,29H,3,8-9,12-13H2,1H3,(H2,28,32) |
| InChIKey | NUVNUDIPDZGGNJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|