C30H31N3O3 — CID 87840487
3,4-dihydro-1H-isoquinolin-2-yl-[4-methoxyimino-1-[2-methyl-6-(2-methylphenyl)benzoyl]pyrrolidin-2-yl]methanone (PubChem CID 87840487) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is 3,4-dihydro-1H-isoquinolin-2-yl-[4-methoxyimino-1-[2-methyl-6-(2-methylphenyl)benzoyl]pyrrolidin-2-yl]methanone.
| Compound Name | 3,4-dihydro-1H-isoquinolin-2-yl-[4-methoxyimino-1-[2-methyl-6-(2-methylphenyl)benzoyl]pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 87840487 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 3,4-dihydro-1H-isoquinolin-2-yl-[4-methoxyimino-1-[2-methyl-6-(2-methylphenyl)benzoyl]pyrrolidin-2-yl]methanone |
| SMILES | CON=C1CC(C(=O)N2CCc3ccccc3C2)N(C(=O)c2c(C)cccc2-c2ccccc2C)C1 |
| InChI | InChI=1S/C30H31N3O3/c1-20-9-4-7-13-25(20)26-14-8-10-21(2)28(26)30(35)33-19-24(31-36-3)17-27(33)29(34)32-16-15-22-11-5-6-12-23(22)18-32/h4-14,27H,15-19H2,1-3H3 |
| InChIKey | RUGPKNSSHYVOPT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|