C15H12Cl2F3N3 — CID 87843307
6-chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]-2-methyl-5-prop-2-enylpyrimidin-4-amine (PubChem CID 87843307) has the molecular formula C15H12Cl2F3N3 and a molecular weight of 362.18 g/mol. Its IUPAC name is 6-chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]-2-methyl-5-prop-2-enylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]-2-methyl-5-prop-2-enylpyrimidin-4-amine |
|---|---|
| PubChem CID | 87843307 |
| Molecular Formula | C15H12Cl2F3N3 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 6-chloro-N-[2-chloro-4-(trifluoromethyl)phenyl]-2-methyl-5-prop-2-enylpyrimidin-4-amine |
| SMILES | C=CCc1c(Cl)nc(C)nc1Nc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H12Cl2F3N3/c1-3-4-10-13(17)21-8(2)22-14(10)23-12-6-5-9(7-11(12)16)15(18,19)20/h3,5-7H,1,4H2,2H3,(H,21,22,23) |
| InChIKey | RHSGXMQWCXNAOZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|