C28H29F9N6O — CID 87846453
1-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl]oxan-4-yl]-7-methyl-N-(2-methyltetrazol-5-yl)-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepin-5-amine (PubChem CID 87846453) has the molecular formula C28H29F9N6O and a molecular weight of 636.56 g/mol. Its IUPAC name is 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl]oxan-4-yl]-7-methyl-N-(2-methyltetrazol-5-yl)-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepin-5-amine.
| Compound Name | 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl]oxan-4-yl]-7-methyl-N-(2-methyltetrazol-5-yl)-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepin-5-amine |
|---|---|
| PubChem CID | 87846453 |
| Molecular Formula | C28H29F9N6O |
| Molecular Weight | 636.56 g/mol |
| Exact Mass | 636.23 |
| IUPAC Name | 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl]oxan-4-yl]-7-methyl-N-(2-methyltetrazol-5-yl)-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepin-5-amine |
| SMILES | Cc1cc2c(cc1C(F)(F)F)N(C1CCOC(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)C1)CCCC2Nc1nnn(C)n1 |
| InChI | InChI=1S/C28H29F9N6O/c1-15-8-21-23(38-25-39-41-42(2)40-25)4-3-6-43(24(21)14-22(15)28(35,36)37)19-5-7-44-20(13-19)11-16-9-17(26(29,30)31)12-18(10-16)27(32,33)34/h8-10,12,14,19-20,23H,3-7,11,13H2,1-2H3,(H,38,40) |
| InChIKey | QLCGPDFXRLDNPK-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |