C26H31N5O3 — CID 87847686
diethylamino 10-[1-(1H-imidazol-2-ylmethyl)piperidin-4-yl]phenoxazine-3-carboxylate (PubChem CID 87847686) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is diethylamino 10-[1-(1H-imidazol-2-ylmethyl)piperidin-4-yl]phenoxazine-3-carboxylate.
| Compound Name | diethylamino 10-[1-(1H-imidazol-2-ylmethyl)piperidin-4-yl]phenoxazine-3-carboxylate |
|---|---|
| PubChem CID | 87847686 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | diethylamino 10-[1-(1H-imidazol-2-ylmethyl)piperidin-4-yl]phenoxazine-3-carboxylate |
| SMILES | CCN(CC)OC(=O)c1ccc2c(c1)Oc1ccccc1N2C1CCN(Cc2ncc[nH]2)CC1 |
| InChI | InChI=1S/C26H31N5O3/c1-3-30(4-2)34-26(32)19-9-10-22-24(17-19)33-23-8-6-5-7-21(23)31(22)20-11-15-29(16-12-20)18-25-27-13-14-28-25/h5-10,13-14,17,20H,3-4,11-12,15-16,18H2,1-2H3,(H,27,28) |
| InChIKey | UNHQQTZYCAKUMC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 73.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|