C13H16F10N2O4S — CID 87848097
1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethanesulfonate (PubChem CID 87848097) has the molecular formula C13H16F10N2O4S and a molecular weight of 486.33 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethanesulfonate.
| Compound Name | 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethanesulfonate |
|---|---|
| PubChem CID | 87848097 |
| Molecular Formula | C13H16F10N2O4S |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethanesulfonate |
| SMILES | CCCCn1cc[n+](C)c1.O=S(=O)([O-])C(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H15N2.C5H2F10O4S/c1-3-4-5-10-7-6-9(2)8-10;6-1(2(7,8)20(16,17)18)19-5(14,15)3(9,10)4(11,12)13/h6-8H,3-5H2,1-2H3;1H,(H,16,17,18)/q+1;/p-1 |
| InChIKey | MAURJFCNRSJLFN-UHFFFAOYSA-M |
| XLogP | 3.34 |
| TPSA | 75.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|