C30H29FN2O6S — CID 87848765
1-[6-[(4-fluorophenyl)methylcarbamoyl]-4,5-bis(phenylmethoxy)-2-pyridinyl]ethyl methanesulfonate (PubChem CID 87848765) has the molecular formula C30H29FN2O6S and a molecular weight of 564.64 g/mol. Its IUPAC name is 1-[6-[(4-fluorophenyl)methylcarbamoyl]-4,5-bis(phenylmethoxy)-2-pyridinyl]ethyl methanesulfonate.
| Compound Name | 1-[6-[(4-fluorophenyl)methylcarbamoyl]-4,5-bis(phenylmethoxy)-2-pyridinyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 87848765 |
| Molecular Formula | C30H29FN2O6S |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 1-[6-[(4-fluorophenyl)methylcarbamoyl]-4,5-bis(phenylmethoxy)-2-pyridinyl]ethyl methanesulfonate |
| SMILES | CC(OS(C)(=O)=O)c1cc(OCc2ccccc2)c(OCc2ccccc2)c(C(=O)NCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C30H29FN2O6S/c1-21(39-40(2,35)36)26-17-27(37-19-23-9-5-3-6-10-23)29(38-20-24-11-7-4-8-12-24)28(33-26)30(34)32-18-22-13-15-25(31)16-14-22/h3-17,21H,18-20H2,1-2H3,(H,32,34) |
| InChIKey | XMRKXNAXCJESFV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|