C31H36N4O6+2 — CID 87848777
(Z)-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-[(4-ethoxycarbonylphenyl)carbamoyl]-[1-[(4-hydroxyphenyl)methyl]-1-methylpyrrolidin-1-ium-3-ylidene]azanium (PubChem CID 87848777) has the molecular formula C31H36N4O6+2 and a molecular weight of 560.65 g/mol. Its IUPAC name is (Z)-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-[(4-ethoxycarbonylphenyl)carbamoyl]-[1-[(4-hydroxyphenyl)methyl]-1-methylpyrrolidin-1-ium-3-ylidene]azanium.
| Compound Name | (Z)-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-[(4-ethoxycarbonylphenyl)carbamoyl]-[1-[(4-hydroxyphenyl)methyl]-1-methylpyrrolidin-1-ium-3-ylidene]azanium |
|---|---|
| PubChem CID | 87848777 |
| Molecular Formula | C31H36N4O6+2 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | (Z)-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-[(4-ethoxycarbonylphenyl)carbamoyl]-[1-[(4-hydroxyphenyl)methyl]-1-methylpyrrolidin-1-ium-3-ylidene]azanium |
| SMILES | CCOC(=O)c1ccc(NC(=O)/[N+](=C2/CC[N+](C)(Cc3ccc(O)cc3)C2)[C@@H](Cc2ccc(O)cc2)C(N)=O)cc1 |
| InChI | InChI=1S/C31H34N4O6/c1-3-41-30(39)23-8-10-24(11-9-23)33-31(40)34(28(29(32)38)18-21-4-12-26(36)13-5-21)25-16-17-35(2,20-25)19-22-6-14-27(37)15-7-22/h4-15,28H,3,16-20H2,1-2H3,(H3-2,32,33,36,37,38,39,40)/p+2/b34-25-/t28-,35?/m0/s1 |
| InChIKey | VFVRJRUIGKDRGV-CJCUHWAMSA-P |
| XLogP | 3.41 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|