C25H28N4O4 — CID 87849613
benzyl 4-[(2S)-2-benzamido-3-(cyanomethylamino)-3-oxopropyl]piperidine-1-carboxylate (PubChem CID 87849613) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is benzyl 4-[(2S)-2-benzamido-3-(cyanomethylamino)-3-oxopropyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(2S)-2-benzamido-3-(cyanomethylamino)-3-oxopropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87849613 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | benzyl 4-[(2S)-2-benzamido-3-(cyanomethylamino)-3-oxopropyl]piperidine-1-carboxylate |
| SMILES | N#CCNC(=O)[C@H](CC1CCN(C(=O)OCc2ccccc2)CC1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H28N4O4/c26-13-14-27-24(31)22(28-23(30)21-9-5-2-6-10-21)17-19-11-15-29(16-12-19)25(32)33-18-20-7-3-1-4-8-20/h1-10,19,22H,11-12,14-18H2,(H,27,31)(H,28,30)/t22-/m0/s1 |
| InChIKey | NKHZSOVBXMSKSS-QFIPXVFZSA-N |
| XLogP | 2.86 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|