C19H16FN3O4 — CID 8785207
[2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-oxo-3H-phthalazine-1-carboxylate (PubChem CID 8785207) has the molecular formula C19H16FN3O4 and a molecular weight of 369.35 g/mol. Its IUPAC name is [2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-oxo-3H-phthalazine-1-carboxylate.
| Compound Name | [2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-oxo-3H-phthalazine-1-carboxylate |
|---|---|
| PubChem CID | 8785207 |
| Molecular Formula | C19H16FN3O4 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | [2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 4-oxo-3H-phthalazine-1-carboxylate |
| SMILES | CN(Cc1cccc(F)c1)C(=O)COC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H16FN3O4/c1-23(10-12-5-4-6-13(20)9-12)16(24)11-27-19(26)17-14-7-2-3-8-15(14)18(25)22-21-17/h2-9H,10-11H2,1H3,(H,22,25) |
| InChIKey | XAGXQBNDXZLJJM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |