C11H10FNO3 — CID 87852626
5-fluoro-3-[(2-methyloxiran-2-yl)methyl]-1,3-benzoxazol-2-one (PubChem CID 87852626) has the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. Its IUPAC name is 5-fluoro-3-[(2-methyloxiran-2-yl)methyl]-1,3-benzoxazol-2-one.
| Compound Name | 5-fluoro-3-[(2-methyloxiran-2-yl)methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 87852626 |
| Molecular Formula | C11H10FNO3 |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 5-fluoro-3-[(2-methyloxiran-2-yl)methyl]-1,3-benzoxazol-2-one |
| SMILES | CC1(Cn2c(=O)oc3ccc(F)cc32)CO1 |
| InChI | InChI=1S/C11H10FNO3/c1-11(6-15-11)5-13-8-4-7(12)2-3-9(8)16-10(13)14/h2-4H,5-6H2,1H3 |
| InChIKey | ACVSHMWBDUEPSN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 47.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|