C16H21NO4S — CID 87854358
N,N-dimethylmethanamine;(2-methylphenoxy) benzenesulfonate (PubChem CID 87854358) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is N,N-dimethylmethanamine;(2-methylphenoxy) benzenesulfonate.
| Compound Name | N,N-dimethylmethanamine;(2-methylphenoxy) benzenesulfonate |
|---|---|
| PubChem CID | 87854358 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N,N-dimethylmethanamine;(2-methylphenoxy) benzenesulfonate |
| SMILES | CN(C)C.Cc1ccccc1OOS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H12O4S.C3H9N/c1-11-7-5-6-10-13(11)16-17-18(14,15)12-8-3-2-4-9-12;1-4(2)3/h2-10H,1H3;1-3H3 |
| InChIKey | GINGZCYJTNHIGZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|