C23H24ClN5O3S — CID 87856277
2-[(5-chlorothiophen-2-yl)carbamoylamino]-N-[4-[(E)-N'-methoxy-N,N-dimethylcarbamimidoyl]phenyl]-2-phenylacetamide (PubChem CID 87856277) has the molecular formula C23H24ClN5O3S and a molecular weight of 486.00 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)carbamoylamino]-N-[4-[(E)-N'-methoxy-N,N-dimethylcarbamimidoyl]phenyl]-2-phenylacetamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)carbamoylamino]-N-[4-[(E)-N'-methoxy-N,N-dimethylcarbamimidoyl]phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 87856277 |
| Molecular Formula | C23H24ClN5O3S |
| Molecular Weight | 486.00 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)carbamoylamino]-N-[4-[(E)-N'-methoxy-N,N-dimethylcarbamimidoyl]phenyl]-2-phenylacetamide |
| SMILES | CO/N=C(\c1ccc(NC(=O)C(NC(=O)Nc2ccc(Cl)s2)c2ccccc2)cc1)N(C)C |
| InChI | InChI=1S/C23H24ClN5O3S/c1-29(2)21(28-32-3)16-9-11-17(12-10-16)25-22(30)20(15-7-5-4-6-8-15)27-23(31)26-19-14-13-18(24)33-19/h4-14,20H,1-3H3,(H,25,30)(H2,26,27,31)/b28-21+ |
| InChIKey | DLTAIGUMHIVWGH-SGWCAAJKSA-N |
| XLogP | 4.77 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.00 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|