C26H26ClN5O3 — CID 85123301
2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-methoxyiminopyrrolidin-1-yl)phenyl]-2-phenylacetamide (PubChem CID 85123301) has the molecular formula C26H26ClN5O3 and a molecular weight of 491.98 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-methoxyiminopyrrolidin-1-yl)phenyl]-2-phenylacetamide.
| Compound Name | 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-methoxyiminopyrrolidin-1-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 85123301 |
| Molecular Formula | C26H26ClN5O3 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-methoxyiminopyrrolidin-1-yl)phenyl]-2-phenylacetamide |
| SMILES | CON=C1CCCN1c1ccc(NC(=O)C(NC(=O)Nc2ccc(Cl)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26ClN5O3/c1-35-31-23-8-5-17-32(23)22-15-13-20(14-16-22)28-25(33)24(18-6-3-2-4-7-18)30-26(34)29-21-11-9-19(27)10-12-21/h2-4,6-7,9-16,24H,5,8,17H2,1H3,(H,28,33)(H2,29,30,34) |
| InChIKey | BNEJWBQQDFVFMN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|