C26H25ClN4O2S — CID 12992876
(2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[3-methyl-4-(2-sulfanylidenepyrrolidin-1-yl)phenyl]-2-phenylacetamide (PubChem CID 12992876) has the molecular formula C26H25ClN4O2S and a molecular weight of 493.03 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[3-methyl-4-(2-sulfanylidenepyrrolidin-1-yl)phenyl]-2-phenylacetamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[3-methyl-4-(2-sulfanylidenepyrrolidin-1-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 12992876 |
| Molecular Formula | C26H25ClN4O2S |
| Molecular Weight | 493.03 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[3-methyl-4-(2-sulfanylidenepyrrolidin-1-yl)phenyl]-2-phenylacetamide |
| SMILES | Cc1cc(NC(=O)[C@H](NC(=O)Nc2ccc(Cl)cc2)c2ccccc2)ccc1N1CCCC1=S |
| InChI | InChI=1S/C26H25ClN4O2S/c1-17-16-21(13-14-22(17)31-15-5-8-23(31)34)28-25(32)24(18-6-3-2-4-7-18)30-26(33)29-20-11-9-19(27)10-12-20/h2-4,6-7,9-14,16,24H,5,8,15H2,1H3,(H,28,32)(H2,29,30,33)/t24-/m1/s1 |
| InChIKey | CPKXAYMVLMQOAT-XMMPIXPASA-N |
| XLogP | 6.08 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.03 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|