C22H21ClFN5O2 — CID 68697720
2-[(4-chlorophenyl)carbamoylamino]-N-[6-fluoro-4-(methylhydrazinylidene)cyclohexa-1,5-dien-1-yl]-2-phenylacetamide (PubChem CID 68697720) has the molecular formula C22H21ClFN5O2 and a molecular weight of 441.89 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoylamino]-N-[6-fluoro-4-(methylhydrazinylidene)cyclohexa-1,5-dien-1-yl]-2-phenylacetamide.
| Compound Name | 2-[(4-chlorophenyl)carbamoylamino]-N-[6-fluoro-4-(methylhydrazinylidene)cyclohexa-1,5-dien-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 68697720 |
| Molecular Formula | C22H21ClFN5O2 |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoylamino]-N-[6-fluoro-4-(methylhydrazinylidene)cyclohexa-1,5-dien-1-yl]-2-phenylacetamide |
| SMILES | CNN=C1C=C(F)C(NC(=O)C(NC(=O)Nc2ccc(Cl)cc2)c2ccccc2)=CC1 |
| InChI | InChI=1S/C22H21ClFN5O2/c1-25-29-17-11-12-19(18(24)13-17)27-21(30)20(14-5-3-2-4-6-14)28-22(31)26-16-9-7-15(23)8-10-16/h2-10,12-13,20,25H,11H2,1H3,(H,27,30)(H2,26,28,31) |
| InChIKey | REBDTXSORBFBAH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|