C25H24ClN5O2 — CID 21088813
2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-iminopyrrolidin-1-yl)phenyl]-2-phenylacetamide (PubChem CID 21088813) has the molecular formula C25H24ClN5O2 and a molecular weight of 461.95 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-iminopyrrolidin-1-yl)phenyl]-2-phenylacetamide.
| Compound Name | 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-iminopyrrolidin-1-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 21088813 |
| Molecular Formula | C25H24ClN5O2 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-iminopyrrolidin-1-yl)phenyl]-2-phenylacetamide |
| SMILES | [H]/N=C1\CCCN1c1ccc(NC(=O)C(NC(=O)Nc2ccc(Cl)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24ClN5O2/c26-18-8-10-20(11-9-18)29-25(33)30-23(17-5-2-1-3-6-17)24(32)28-19-12-14-21(15-13-19)31-16-4-7-22(31)27/h1-3,5-6,8-15,23,27H,4,7,16H2,(H,28,32)(H2,29,30,33)/b27-22+ |
| InChIKey | PTQVLPWBQCFYML-HPNDGRJYSA-N |
| XLogP | 5.42 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|