C26H24ClFN4O3 — CID 21088824
[1-(2-fluorophenyl)-2-[4-(2-iminopiperidin-1-yl)anilino]-2-oxoethyl] N-(4-chlorophenyl)carbamate (PubChem CID 21088824) has the molecular formula C26H24ClFN4O3 and a molecular weight of 494.95 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-2-[4-(2-iminopiperidin-1-yl)anilino]-2-oxoethyl] N-(4-chlorophenyl)carbamate.
| Compound Name | [1-(2-fluorophenyl)-2-[4-(2-iminopiperidin-1-yl)anilino]-2-oxoethyl] N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 21088824 |
| Molecular Formula | C26H24ClFN4O3 |
| Molecular Weight | 494.95 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | [1-(2-fluorophenyl)-2-[4-(2-iminopiperidin-1-yl)anilino]-2-oxoethyl] N-(4-chlorophenyl)carbamate |
| SMILES | [H]/N=C1\CCCCN1c1ccc(NC(=O)C(OC(=O)Nc2ccc(Cl)cc2)c2ccccc2F)cc1 |
| InChI | InChI=1S/C26H24ClFN4O3/c27-17-8-10-19(11-9-17)31-26(34)35-24(21-5-1-2-6-22(21)28)25(33)30-18-12-14-20(15-13-18)32-16-4-3-7-23(32)29/h1-2,5-6,8-15,24,29H,3-4,7,16H2,(H,30,33)(H,31,34)/b29-23+ |
| InChIKey | PXRMAFBZUOJIPL-BYNJWEBRSA-N |
| XLogP | 6.38 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.95 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|