C24H23ClN4O3S — CID 10368008
[(1R)-2-[4-(2-iminopiperidin-1-yl)anilino]-2-oxo-1-phenylethyl] N-(5-chlorothiophen-2-yl)carbamate (PubChem CID 10368008) has the molecular formula C24H23ClN4O3S and a molecular weight of 482.99 g/mol. Its IUPAC name is [(1R)-2-[4-(2-iminopiperidin-1-yl)anilino]-2-oxo-1-phenylethyl] N-(5-chlorothiophen-2-yl)carbamate.
| Compound Name | [(1R)-2-[4-(2-iminopiperidin-1-yl)anilino]-2-oxo-1-phenylethyl] N-(5-chlorothiophen-2-yl)carbamate |
|---|---|
| PubChem CID | 10368008 |
| Molecular Formula | C24H23ClN4O3S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | [(1R)-2-[4-(2-iminopiperidin-1-yl)anilino]-2-oxo-1-phenylethyl] N-(5-chlorothiophen-2-yl)carbamate |
| SMILES | [H]/N=C1\CCCCN1c1ccc(NC(=O)[C@H](OC(=O)Nc2ccc(Cl)s2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23ClN4O3S/c25-19-13-14-21(33-19)28-24(31)32-22(16-6-2-1-3-7-16)23(30)27-17-9-11-18(12-10-17)29-15-5-4-8-20(29)26/h1-3,6-7,9-14,22,26H,4-5,8,15H2,(H,27,30)(H,28,31)/b26-20+/t22-/m1/s1 |
| InChIKey | RXIWYMILDKEDPG-PHRANEHHSA-N |
| XLogP | 6.30 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|