C24H22ClN5O2S — CID 68820022
2-[[2-(5-chlorothiophen-2-yl)-3H-benzimidazol-5-yl]oxy]-N-[4-(2-iminopiperidin-1-yl)phenyl]acetamide (PubChem CID 68820022) has the molecular formula C24H22ClN5O2S and a molecular weight of 479.99 g/mol. Its IUPAC name is 2-[[2-(5-chlorothiophen-2-yl)-3H-benzimidazol-5-yl]oxy]-N-[4-(2-iminopiperidin-1-yl)phenyl]acetamide.
| Compound Name | 2-[[2-(5-chlorothiophen-2-yl)-3H-benzimidazol-5-yl]oxy]-N-[4-(2-iminopiperidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 68820022 |
| Molecular Formula | C24H22ClN5O2S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 2-[[2-(5-chlorothiophen-2-yl)-3H-benzimidazol-5-yl]oxy]-N-[4-(2-iminopiperidin-1-yl)phenyl]acetamide |
| SMILES | [H]/N=C1\CCCCN1c1ccc(NC(=O)COc2ccc3nc(-c4ccc(Cl)s4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C24H22ClN5O2S/c25-21-11-10-20(33-21)24-28-18-9-8-17(13-19(18)29-24)32-14-23(31)27-15-4-6-16(7-5-15)30-12-2-1-3-22(30)26/h4-11,13,26H,1-3,12,14H2,(H,27,31)(H,28,29)/b26-22+ |
| InChIKey | GWDPIDQBZCTRRE-XTCLZLMSSA-N |
| XLogP | 5.93 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|