C26H26ClN5O2 — CID 11754720
(2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-iminopiperidin-1-yl)phenyl]-2-phenylacetamide (PubChem CID 11754720) has the molecular formula C26H26ClN5O2 and a molecular weight of 475.98 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-iminopiperidin-1-yl)phenyl]-2-phenylacetamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-iminopiperidin-1-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 11754720 |
| Molecular Formula | C26H26ClN5O2 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-iminopiperidin-1-yl)phenyl]-2-phenylacetamide |
| SMILES | [H]/N=C1\CCCCN1c1ccc(NC(=O)[C@H](NC(=O)Nc2ccc(Cl)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26ClN5O2/c27-19-9-11-21(12-10-19)30-26(34)31-24(18-6-2-1-3-7-18)25(33)29-20-13-15-22(16-14-20)32-17-5-4-8-23(32)28/h1-3,6-7,9-16,24,28H,4-5,8,17H2,(H,29,33)(H2,30,31,34)/b28-23+/t24-/m1/s1 |
| InChIKey | YOKAEAHBWZYQIH-SHMWJOFESA-N |
| XLogP | 5.81 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|