C22H24ClN5O4 — CID 69439819
2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-oxopiperidin-1-yl)phenyl]butanediamide (PubChem CID 69439819) has the molecular formula C22H24ClN5O4 and a molecular weight of 457.92 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-oxopiperidin-1-yl)phenyl]butanediamide.
| Compound Name | 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-oxopiperidin-1-yl)phenyl]butanediamide |
|---|---|
| PubChem CID | 69439819 |
| Molecular Formula | C22H24ClN5O4 |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(2-oxopiperidin-1-yl)phenyl]butanediamide |
| SMILES | NC(=O)CC(NC(=O)Nc1ccc(Cl)cc1)C(=O)Nc1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C22H24ClN5O4/c23-14-4-6-16(7-5-14)26-22(32)27-18(13-19(24)29)21(31)25-15-8-10-17(11-9-15)28-12-2-1-3-20(28)30/h4-11,18H,1-3,12-13H2,(H2,24,29)(H,25,31)(H2,26,27,32) |
| InChIKey | XIOBCXWJRJVQDR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |