C22H26ClN5O5S — CID 90846289
4-(amino-methyl-oxo-λ6-sulfanylidene)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-(3-oxomorpholin-4-yl)phenyl]butanamide (PubChem CID 90846289) has the molecular formula C22H26ClN5O5S and a molecular weight of 508.00 g/mol. Its IUPAC name is 4-(amino-methyl-oxo-λ6-sulfanylidene)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-(3-oxomorpholin-4-yl)phenyl]butanamide.
| Compound Name | 4-(amino-methyl-oxo-λ6-sulfanylidene)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-(3-oxomorpholin-4-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 90846289 |
| Molecular Formula | C22H26ClN5O5S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 4-(amino-methyl-oxo-λ6-sulfanylidene)-2-[(4-chlorophenyl)carbamoylamino]-N-[4-(3-oxomorpholin-4-yl)phenyl]butanamide |
| SMILES | CS(N)(=O)=CCC(NC(=O)Nc1ccc(Cl)cc1)C(=O)Nc1ccc(N2CCOCC2=O)cc1 |
| InChI | InChI=1S/C22H26ClN5O5S/c1-34(24,32)13-10-19(27-22(31)26-17-4-2-15(23)3-5-17)21(30)25-16-6-8-18(9-7-16)28-11-12-33-14-20(28)29/h2-9,13,19H,10-12,14H2,1H3,(H2,24,32)(H,25,30)(H2,26,27,31) |
| InChIKey | PSKSAIMRGOJPFX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|