C42H37ClN6O4 — CID 174777568
2-[(4-chlorophenyl)carbamoylamino]-N-[4-(3-oxomorpholin-4-yl)phenyl]-3-(3-tritylimidazol-4-yl)propanamide (PubChem CID 174777568) has the molecular formula C42H37ClN6O4 and a molecular weight of 725.25 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(3-oxomorpholin-4-yl)phenyl]-3-(3-tritylimidazol-4-yl)propanamide.
| Compound Name | 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(3-oxomorpholin-4-yl)phenyl]-3-(3-tritylimidazol-4-yl)propanamide |
|---|---|
| PubChem CID | 174777568 |
| Molecular Formula | C42H37ClN6O4 |
| Molecular Weight | 725.25 g/mol |
| Exact Mass | 724.26 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoylamino]-N-[4-(3-oxomorpholin-4-yl)phenyl]-3-(3-tritylimidazol-4-yl)propanamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)NC(Cc1cncn1C(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)Nc1ccc(N2CCOCC2=O)cc1 |
| InChI | InChI=1S/C42H37ClN6O4/c43-33-16-18-35(19-17-33)46-41(52)47-38(40(51)45-34-20-22-36(23-21-34)48-24-25-53-28-39(48)50)26-37-27-44-29-49(37)42(30-10-4-1-5-11-30,31-12-6-2-7-13-31)32-14-8-3-9-15-32/h1-23,27,29,38H,24-26,28H2,(H,45,51)(H2,46,47,52) |
| InChIKey | KWJQOJKGAFXAPG-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.25 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|