About trimethyl(nonyl)azanium formate
trimethyl(nonyl)azanium formate (PubChem CID 87856984) has the molecular formula C13H29NO2
and a molecular weight of 231.38 g/mol. Its IUPAC name is trimethyl(nonyl)azanium formate.
Molecular Properties
| Compound Name | trimethyl(nonyl)azanium formate |
| PubChem CID | 87856984 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | trimethyl(nonyl)azanium formate |
| SMILES | CCCCCCCCC[N+](C)(C)C.O=C[O-] |
| InChI | InChI=1S/C12H28N.CH2O2/c1-5-6-7-8-9-10-11-12-13(2,3)4;2-1-3/h5-12H2,1-4H3;1H,(H,2,3)/q+1;/p-1 |
| InChIKey | DRPJBMFPCBWILG-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(nonyl)azanium formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(nonyl)azanium formate?
The IUPAC name of trimethyl(nonyl)azanium formate (CID 87856984) is trimethyl(nonyl)azanium formate.
What is the SMILES notation for trimethyl(nonyl)azanium formate?
The canonical SMILES for trimethyl(nonyl)azanium formate is CCCCCCCCC[N+](C)(C)C.O=C[O-].
What is the InChIKey of trimethyl(nonyl)azanium formate?
The InChIKey is DRPJBMFPCBWILG-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H28N.CH2O2/c1-5-6-7-8-9-10-11-12-13(2,3)4;2-1-3/h5-12H2,1-4H3;1H,(H,2,3)/q+1;/p-1.
What are the key properties of trimethyl(nonyl)azanium formate?
trimethyl(nonyl)azanium formate has a molecular weight of 231.38 g/mol, XLogP of 1.81, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(nonyl)azanium formate is sourced from PubChem (CID 87856984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).