About methyl(trioctyl)azanium formate
methyl(trioctyl)azanium formate (PubChem CID 71332954) has the molecular formula C26H55NO2
and a molecular weight of 413.73 g/mol. Its IUPAC name is methyl(trioctyl)azanium formate.
Molecular Properties
| Compound Name | methyl(trioctyl)azanium formate |
| PubChem CID | 71332954 |
| Molecular Formula | C26H55NO2 |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 413.42 |
| IUPAC Name | methyl(trioctyl)azanium formate |
| SMILES | CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.O=C[O-] |
| InChI | InChI=1S/C25H54N.CH2O2/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;2-1-3/h5-25H2,1-4H3;1H,(H,2,3)/q+1;/p-1 |
| InChIKey | CECWRXGFOKCKTO-UHFFFAOYSA-M |
| XLogP | 6.88 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze methyl(trioctyl)azanium formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl(trioctyl)azanium formate?
The IUPAC name of methyl(trioctyl)azanium formate (CID 71332954) is methyl(trioctyl)azanium formate.
What is the SMILES notation for methyl(trioctyl)azanium formate?
The canonical SMILES for methyl(trioctyl)azanium formate is CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.O=C[O-].
What is the InChIKey of methyl(trioctyl)azanium formate?
The InChIKey is CECWRXGFOKCKTO-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H54N.CH2O2/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;2-1-3/h5-25H2,1-4H3;1H,(H,2,3)/q+1;/p-1.
What are the key properties of methyl(trioctyl)azanium formate?
methyl(trioctyl)azanium formate has a molecular weight of 413.73 g/mol, XLogP of 6.88, 21 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl(trioctyl)azanium formate is sourced from PubChem (CID 71332954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).