C22H20F3N3O2 — CID 87858763
2-(pyridin-4-ylmethylamino)-N-[2-[2-(trifluoromethyl)phenyl]ethoxy]benzamide (PubChem CID 87858763) has the molecular formula C22H20F3N3O2 and a molecular weight of 415.42 g/mol. Its IUPAC name is 2-(pyridin-4-ylmethylamino)-N-[2-[2-(trifluoromethyl)phenyl]ethoxy]benzamide.
| Compound Name | 2-(pyridin-4-ylmethylamino)-N-[2-[2-(trifluoromethyl)phenyl]ethoxy]benzamide |
|---|---|
| PubChem CID | 87858763 |
| Molecular Formula | C22H20F3N3O2 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-(pyridin-4-ylmethylamino)-N-[2-[2-(trifluoromethyl)phenyl]ethoxy]benzamide |
| SMILES | O=C(NOCCc1ccccc1C(F)(F)F)c1ccccc1NCc1ccncc1 |
| InChI | InChI=1S/C22H20F3N3O2/c23-22(24,25)19-7-3-1-5-17(19)11-14-30-28-21(29)18-6-2-4-8-20(18)27-15-16-9-12-26-13-10-16/h1-10,12-13,27H,11,14-15H2,(H,28,29) |
| InChIKey | PXVJXZVINJPVRM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|