About 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid
2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid (PubChem CID 87860561) has the molecular formula C14H18O4
and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid.
Molecular Properties
| Compound Name | 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid |
| PubChem CID | 87860561 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid |
| SMILES | Cc1cc(O)c(O)c(C(=O)O)c1C1CCCCC1 |
| InChI | InChI=1S/C14H18O4/c1-8-7-10(15)13(16)12(14(17)18)11(8)9-5-3-2-4-6-9/h7,9,15-16H,2-6H2,1H3,(H,17,18) |
| InChIKey | HAOGBKWVOWVDDO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid?
The IUPAC name of 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid (CID 87860561) is 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid.
What is the SMILES notation for 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid?
The canonical SMILES for 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid is Cc1cc(O)c(O)c(C(=O)O)c1C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid?
The InChIKey is HAOGBKWVOWVDDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c1-8-7-10(15)13(16)12(14(17)18)11(8)9-5-3-2-4-6-9/h7,9,15-16H,2-6H2,1H3,(H,17,18).
What are the key properties of 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid?
2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid has a molecular weight of 250.29 g/mol, XLogP of 3.15, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid is sourced from PubChem (CID 87860561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).