C14H18O4 — CID 87860561
2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid (PubChem CID 87860561) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid.
| Compound Name | 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 87860561 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-cyclohexyl-5,6-dihydroxy-3-methylbenzoic acid |
| SMILES | Cc1cc(O)c(O)c(C(=O)O)c1C1CCCCC1 |
| InChI | InChI=1S/C14H18O4/c1-8-7-10(15)13(16)12(14(17)18)11(8)9-5-3-2-4-6-9/h7,9,15-16H,2-6H2,1H3,(H,17,18) |
| InChIKey | HAOGBKWVOWVDDO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|