C11H8Cl2N2O4 — CID 87861460
3-(2-methyl-5-nitrophenyl)-1,2-oxazole-5-carbonyl chloride;hydrochloride (PubChem CID 87861460) has the molecular formula C11H8Cl2N2O4 and a molecular weight of 303.10 g/mol. Its IUPAC name is 3-(2-methyl-5-nitrophenyl)-1,2-oxazole-5-carbonyl chloride;hydrochloride.
| Compound Name | 3-(2-methyl-5-nitrophenyl)-1,2-oxazole-5-carbonyl chloride;hydrochloride |
|---|---|
| PubChem CID | 87861460 |
| Molecular Formula | C11H8Cl2N2O4 |
| Molecular Weight | 303.10 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 3-(2-methyl-5-nitrophenyl)-1,2-oxazole-5-carbonyl chloride;hydrochloride |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1cc(C(=O)Cl)on1.Cl |
| InChI | InChI=1S/C11H7ClN2O4.ClH/c1-6-2-3-7(14(16)17)4-8(6)9-5-10(11(12)15)18-13-9;/h2-5H,1H3;1H |
| InChIKey | AEZBIRMIACNKCL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.10 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|