C20H25F5O — CID 87862554
(2R,4aS,6S,8aR)-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 87862554) has the molecular formula C20H25F5O and a molecular weight of 376.41 g/mol. Its IUPAC name is (2R,4aS,6S,8aR)-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aS,6S,8aR)-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 87862554 |
| Molecular Formula | C20H25F5O |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (2R,4aS,6S,8aR)-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]-6-propyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCC[C@H]1CC[C@@H]2C[C@H](COc3c(F)c(F)c(F)c(F)c3F)CC[C@H]2C1 |
| InChI | InChI=1S/C20H25F5O/c1-2-3-11-4-6-14-9-12(5-7-13(14)8-11)10-26-20-18(24)16(22)15(21)17(23)19(20)25/h11-14H,2-10H2,1H3/t11-,12+,13-,14+/m0/s1 |
| InChIKey | UURLRYYBXOBYFE-RFQIPJPRSA-N |
| XLogP | 6.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|