C18H22ClN3O4 — CID 87862949
2-methylpropyl 7-chloro-3-methyl-4-(morpholine-4-carbonyl)pyrrolo[2,3-c]pyridine-1-carboxylate (PubChem CID 87862949) has the molecular formula C18H22ClN3O4 and a molecular weight of 379.84 g/mol. Its IUPAC name is 2-methylpropyl 7-chloro-3-methyl-4-(morpholine-4-carbonyl)pyrrolo[2,3-c]pyridine-1-carboxylate.
| Compound Name | 2-methylpropyl 7-chloro-3-methyl-4-(morpholine-4-carbonyl)pyrrolo[2,3-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 87862949 |
| Molecular Formula | C18H22ClN3O4 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-methylpropyl 7-chloro-3-methyl-4-(morpholine-4-carbonyl)pyrrolo[2,3-c]pyridine-1-carboxylate |
| SMILES | Cc1cn(C(=O)OCC(C)C)c2c(Cl)ncc(C(=O)N3CCOCC3)c12 |
| InChI | InChI=1S/C18H22ClN3O4/c1-11(2)10-26-18(24)22-9-12(3)14-13(8-20-16(19)15(14)22)17(23)21-4-6-25-7-5-21/h8-9,11H,4-7,10H2,1-3H3 |
| InChIKey | TVSCAZCHSADNQJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|