C14H18F3N7 — CID 87864007
N-(5-methyl-1H-pyrazol-3-yl)-6-[[4-(trifluoromethyl)piperazin-1-yl]methyl]pyrazin-2-amine (PubChem CID 87864007) has the molecular formula C14H18F3N7 and a molecular weight of 341.34 g/mol. Its IUPAC name is N-(5-methyl-1H-pyrazol-3-yl)-6-[[4-(trifluoromethyl)piperazin-1-yl]methyl]pyrazin-2-amine.
| Compound Name | N-(5-methyl-1H-pyrazol-3-yl)-6-[[4-(trifluoromethyl)piperazin-1-yl]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 87864007 |
| Molecular Formula | C14H18F3N7 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N-(5-methyl-1H-pyrazol-3-yl)-6-[[4-(trifluoromethyl)piperazin-1-yl]methyl]pyrazin-2-amine |
| SMILES | Cc1cc(Nc2cncc(CN3CCN(C(F)(F)F)CC3)n2)n[nH]1 |
| InChI | InChI=1S/C14H18F3N7/c1-10-6-12(22-21-10)20-13-8-18-7-11(19-13)9-23-2-4-24(5-3-23)14(15,16)17/h6-8H,2-5,9H2,1H3,(H2,19,20,21,22) |
| InChIKey | SHRHOTAYSSQCDO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|