C22H42O5Sn2 — CID 87864364
(butyl-prop-2-enoyloxy-tributylstannyloxystannyl) prop-2-enoate (PubChem CID 87864364) has the molecular formula C22H42O5Sn2 and a molecular weight of 624.00 g/mol. Its IUPAC name is (butyl-prop-2-enoyloxy-tributylstannyloxystannyl) prop-2-enoate.
| Compound Name | (butyl-prop-2-enoyloxy-tributylstannyloxystannyl) prop-2-enoate |
|---|---|
| PubChem CID | 87864364 |
| Molecular Formula | C22H42O5Sn2 |
| Molecular Weight | 624.00 g/mol |
| Exact Mass | 626.11 |
| IUPAC Name | (butyl-prop-2-enoyloxy-tributylstannyloxystannyl) prop-2-enoate |
| SMILES | C=CC(=O)O[Sn](CCCC)(OC(=O)C=C)O[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/4C4H9.2C3H4O2.O.2Sn/c4*1-3-4-2;2*1-2-3(4)5;;;/h4*1,3-4H2,2H3;2*2H,1H2,(H,4,5);;;/q;;;;;;;;+2/p-2 |
| InChIKey | UHYDFKDFYURSDW-UHFFFAOYSA-L |
| XLogP | 6.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.00 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|