About chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride
chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride (PubChem CID 87864460) has the molecular formula C19H14Cl2CrN
and a molecular weight of 379.23 g/mol. Its IUPAC name is chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride.
Molecular Properties
| Compound Name | chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride |
| PubChem CID | 87864460 |
| Molecular Formula | C19H14Cl2CrN |
| Molecular Weight | 379.23 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride |
| SMILES | [Cl-].[Cl-].[Cr+3].c1ccc2[cH-]c(Cc3cccc4cccnc34)cc2c1 |
| InChI | InChI=1S/C19H14N.2ClH.Cr/c1-2-6-17-12-14(11-16(17)5-1)13-18-8-3-7-15-9-4-10-20-19(15)18;;;/h1-12H,13H2;2*1H;/q-1;;;+3/p-2 |
| InChIKey | CXXAFLJUVZHIGV-UHFFFAOYSA-L |
| XLogP | -1.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.23 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride?
The IUPAC name of chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride (CID 87864460) is chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride.
What is the SMILES notation for chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride?
The canonical SMILES for chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride is [Cl-].[Cl-].[Cr+3].c1ccc2[cH-]c(Cc3cccc4cccnc34)cc2c1.
What is the InChIKey of chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride?
The InChIKey is CXXAFLJUVZHIGV-UHFFFAOYSA-L. The full InChI is InChI=1S/C19H14N.2ClH.Cr/c1-2-6-17-12-14(11-16(17)5-1)13-18-8-3-7-15-9-4-10-20-19(15)18;;;/h1-12H,13H2;2*1H;/q-1;;;+3/p-2.
What are the key properties of chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride?
chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride has a molecular weight of 379.23 g/mol, XLogP of -1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chromium(3+);8-(1H-inden-1-id-2-ylmethyl)quinoline;dichloride is sourced from PubChem (CID 87864460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).