C14H10Cl2N2O4 — CID 8786481
[2-(2,5-dichloroanilino)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate (PubChem CID 8786481) has the molecular formula C14H10Cl2N2O4 and a molecular weight of 341.15 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 8786481 |
| Molecular Formula | C14H10Cl2N2O4 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccc[nH]c1=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H10Cl2N2O4/c15-8-3-4-10(16)11(6-8)18-12(19)7-22-14(21)9-2-1-5-17-13(9)20/h1-6H,7H2,(H,17,20)(H,18,19) |
| InChIKey | XPDPSIDOQWIMKR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |