C27H27Cl2Zr- — CID 87865079
dichlorozirconium;4-(2-phenylphenyl)-2,5-di(propan-2-yl)-1H-inden-1-ide (PubChem CID 87865079) has the molecular formula C27H27Cl2Zr- and a molecular weight of 513.64 g/mol. Its IUPAC name is dichlorozirconium;4-(2-phenylphenyl)-2,5-di(propan-2-yl)-1H-inden-1-ide.
| Compound Name | dichlorozirconium;4-(2-phenylphenyl)-2,5-di(propan-2-yl)-1H-inden-1-ide |
|---|---|
| PubChem CID | 87865079 |
| Molecular Formula | C27H27Cl2Zr- |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | dichlorozirconium;4-(2-phenylphenyl)-2,5-di(propan-2-yl)-1H-inden-1-ide |
| SMILES | CC(C)c1cc2c(-c3ccccc3-c3ccccc3)c(C(C)C)ccc2[cH-]1.Cl[Zr]Cl |
| InChI | InChI=1S/C27H27.2ClH.Zr/c1-18(2)22-16-21-14-15-23(19(3)4)27(26(21)17-22)25-13-9-8-12-24(25)20-10-6-5-7-11-20;;;/h5-19H,1-4H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | LNZGFZXQHPQTAL-UHFFFAOYSA-L |
| XLogP | 9.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|