C12H18Cl2O4 — CID 87865505
diethyl (Z)-2-(1,4-dichlorobutan-2-yl)but-2-enedioate (PubChem CID 87865505) has the molecular formula C12H18Cl2O4 and a molecular weight of 297.18 g/mol. Its IUPAC name is diethyl (Z)-2-(1,4-dichlorobutan-2-yl)but-2-enedioate.
| Compound Name | diethyl (Z)-2-(1,4-dichlorobutan-2-yl)but-2-enedioate |
|---|---|
| PubChem CID | 87865505 |
| Molecular Formula | C12H18Cl2O4 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | diethyl (Z)-2-(1,4-dichlorobutan-2-yl)but-2-enedioate |
| SMILES | CCOC(=O)/C=C(\C(=O)OCC)C(CCl)CCCl |
| InChI | InChI=1S/C12H18Cl2O4/c1-3-17-11(15)7-10(12(16)18-4-2)9(8-14)5-6-13/h7,9H,3-6,8H2,1-2H3/b10-7- |
| InChIKey | KGWUWCQWEUKGKT-YFHOEESVSA-N |
| XLogP | 2.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|