C20H24FN7O2 — CID 87869095
1-[2-[2-[(N'-cyano-N,N-dimethylcarbamimidoyl)-methylamino]propan-2-yloxy]-3-fluorophenyl]-3-pyridin-3-ylurea (PubChem CID 87869095) has the molecular formula C20H24FN7O2 and a molecular weight of 413.46 g/mol. Its IUPAC name is 1-[2-[2-[(N'-cyano-N,N-dimethylcarbamimidoyl)-methylamino]propan-2-yloxy]-3-fluorophenyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[2-[2-[(N'-cyano-N,N-dimethylcarbamimidoyl)-methylamino]propan-2-yloxy]-3-fluorophenyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 87869095 |
| Molecular Formula | C20H24FN7O2 |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 1-[2-[2-[(N'-cyano-N,N-dimethylcarbamimidoyl)-methylamino]propan-2-yloxy]-3-fluorophenyl]-3-pyridin-3-ylurea |
| SMILES | CN(C)/C(=N\C#N)N(C)C(C)(C)Oc1c(F)cccc1NC(=O)Nc1cccnc1 |
| InChI | InChI=1S/C20H24FN7O2/c1-20(2,28(5)19(24-13-22)27(3)4)30-17-15(21)9-6-10-16(17)26-18(29)25-14-8-7-11-23-12-14/h6-12H,1-5H3,(H2,25,26,29)/b24-19+ |
| InChIKey | TZHRGYDSZARMLJ-LYBHJNIJSA-N |
| XLogP | 3.31 |
| TPSA | 105.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|