About [(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium
[(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium (PubChem CID 87871084) has the molecular formula C22H28NOSiTi+
and a molecular weight of 398.43 g/mol. Its IUPAC name is [(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium.
Molecular Properties
| Compound Name | [(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium |
| PubChem CID | 87871084 |
| Molecular Formula | C22H28NOSiTi+ |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium |
| SMILES | CC(C)(C)[N+](C)(C)[Si](=O)C1C(Cc2ccccc2)=Cc2ccccc21.[Ti] |
| InChI | InChI=1S/C22H28NOSi.Ti/c1-22(2,3)23(4,5)25(24)21-19(15-17-11-7-6-8-12-17)16-18-13-9-10-14-20(18)21;/h6-14,16,21H,15H2,1-5H3;/q+1; |
| InChIKey | KCGDWIOYFXRBBV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium?
The IUPAC name of [(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium (CID 87871084) is [(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium.
What is the SMILES notation for [(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium?
The canonical SMILES for [(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium is CC(C)(C)[N+](C)(C)[Si](=O)C1C(Cc2ccccc2)=Cc2ccccc21.[Ti].
What is the InChIKey of [(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium?
The InChIKey is KCGDWIOYFXRBBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28NOSi.Ti/c1-22(2,3)23(4,5)25(24)21-19(15-17-11-7-6-8-12-17)16-18-13-9-10-14-20(18)21;/h6-14,16,21H,15H2,1-5H3;/q+1;.
What are the key properties of [(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium?
[(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium has a molecular weight of 398.43 g/mol, XLogP of 4.74, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-benzyl-1H-inden-1-yl)-oxosilyl]-tert-butyl-dimethylazanium;titanium is sourced from PubChem (CID 87871084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).