C17H22 — CID 173422098
1-cyclohexyl-2-ethyl-1H-indene (PubChem CID 173422098) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-cyclohexyl-2-ethyl-1H-indene.
| Compound Name | 1-cyclohexyl-2-ethyl-1H-indene |
|---|---|
| PubChem CID | 173422098 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-cyclohexyl-2-ethyl-1H-indene |
| SMILES | CCC1=Cc2ccccc2C1C1CCCCC1 |
| InChI | InChI=1S/C17H22/c1-2-13-12-15-10-6-7-11-16(15)17(13)14-8-4-3-5-9-14/h6-7,10-12,14,17H,2-5,8-9H2,1H3 |
| InChIKey | QUOHYDIYLGDJDV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |