C19H26 — CID 91054217
5,6,7,8,9,10,11,12,13,14-decahydro-4bH-cyclododeca[a]indene (PubChem CID 91054217) has the molecular formula C19H26 and a molecular weight of 254.42 g/mol. Its IUPAC name is 5,6,7,8,9,10,11,12,13,14-decahydro-4bH-cyclododeca[a]indene.
| Compound Name | 5,6,7,8,9,10,11,12,13,14-decahydro-4bH-cyclododeca[a]indene |
|---|---|
| PubChem CID | 91054217 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 5,6,7,8,9,10,11,12,13,14-decahydro-4bH-cyclododeca[a]indene |
| SMILES | C1=C2CCCCCCCCCCC2c2ccccc21 |
| InChI | InChI=1S/C19H26/c1-2-4-6-8-13-18-16(11-7-5-3-1)15-17-12-9-10-14-19(17)18/h9-10,12,14-15,18H,1-8,11,13H2 |
| InChIKey | SMPOEMXUKORNDH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |