C23H32O2P2+2 — CID 146502994
3,19-diphosphoniatetracyclo[20.2.1.06,14.08,13]pentacosa-6,8,10,12-tetraene 3,19-dioxide (PubChem CID 146502994) has the molecular formula C23H32O2P2+2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 3,19-diphosphoniatetracyclo[20.2.1.06,14.08,13]pentacosa-6,8,10,12-tetraene 3,19-dioxide.
| Compound Name | 3,19-diphosphoniatetracyclo[20.2.1.06,14.08,13]pentacosa-6,8,10,12-tetraene 3,19-dioxide |
|---|---|
| PubChem CID | 146502994 |
| Molecular Formula | C23H32O2P2+2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 3,19-diphosphoniatetracyclo[20.2.1.06,14.08,13]pentacosa-6,8,10,12-tetraene 3,19-dioxide |
| SMILES | O=[P+]1CCCCC2C(=Cc3ccccc32)CC[P+](=O)CC2CCC(CC1)C2 |
| InChI | InChI=1S/C23H32O2P2/c24-26-12-4-3-7-23-21(16-20-5-1-2-6-22(20)23)11-14-27(25)17-19-9-8-18(15-19)10-13-26/h1-2,5-6,16,18-19,23H,3-4,7-15,17H2/q+2 |
| InChIKey | YCRVHCIQSXXSDJ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|