C25H19F10NO3 — CID 87873792
3-[[[3-[3-(difluoromethoxy)phenoxy]phenyl]-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 87873792) has the molecular formula C25H19F10NO3 and a molecular weight of 571.41 g/mol. Its IUPAC name is 3-[[[3-[3-(difluoromethoxy)phenoxy]phenyl]-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[[[3-[3-(difluoromethoxy)phenoxy]phenyl]-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 87873792 |
| Molecular Formula | C25H19F10NO3 |
| Molecular Weight | 571.41 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | 3-[[[3-[3-(difluoromethoxy)phenoxy]phenyl]-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(CNC(c1cccc(Oc2cccc(OC(F)F)c2)c1)c1cccc(C(F)(F)C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C25H19F10NO3/c26-22(27)39-19-9-3-8-18(12-19)38-17-7-2-5-15(11-17)21(36-13-20(37)24(30,31)32)14-4-1-6-16(10-14)23(28,29)25(33,34)35/h1-12,20-22,36-37H,13H2 |
| InChIKey | ZAJXTLWVOIDUOS-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.41 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|