C20H32N3O2S+ — CID 8787517
N-cyclohexyl-4-[(2,5-dimethoxyphenyl)methyl]piperazin-4-ium-1-carbothioamide (PubChem CID 8787517) has the molecular formula C20H32N3O2S+ and a molecular weight of 378.56 g/mol. Its IUPAC name is N-cyclohexyl-4-[(2,5-dimethoxyphenyl)methyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | N-cyclohexyl-4-[(2,5-dimethoxyphenyl)methyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 8787517 |
| Molecular Formula | C20H32N3O2S+ |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | N-cyclohexyl-4-[(2,5-dimethoxyphenyl)methyl]piperazin-4-ium-1-carbothioamide |
| SMILES | COc1ccc(OC)c(C[NH+]2CCN(C(=S)NC3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C20H31N3O2S/c1-24-18-8-9-19(25-2)16(14-18)15-22-10-12-23(13-11-22)20(26)21-17-6-4-3-5-7-17/h8-9,14,17H,3-7,10-13,15H2,1-2H3,(H,21,26)/p+1 |
| InChIKey | HXKWIQAYHLLDPW-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 38.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|