C18H21NO2S — CID 87877068
[4-[(4S)-4-amino-5-sulfanylpentoxy]phenyl]-phenylmethanone (PubChem CID 87877068) has the molecular formula C18H21NO2S and a molecular weight of 315.44 g/mol. Its IUPAC name is [4-[(4S)-4-amino-5-sulfanylpentoxy]phenyl]-phenylmethanone.
| Compound Name | [4-[(4S)-4-amino-5-sulfanylpentoxy]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 87877068 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | [4-[(4S)-4-amino-5-sulfanylpentoxy]phenyl]-phenylmethanone |
| SMILES | N[C@H](CS)CCCOc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H21NO2S/c19-16(13-22)7-4-12-21-17-10-8-15(9-11-17)18(20)14-5-2-1-3-6-14/h1-3,5-6,8-11,16,22H,4,7,12-13,19H2/t16-/m0/s1 |
| InChIKey | KVUMCCUNYMATMB-INIZCTEOSA-N |
| XLogP | 3.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|