C17H23NO3S3 — CID 87879504
[(2S)-2-methyl-3-sulfanylpropanoyl] (2S)-2-[(4-methylsulfanylphenyl)methylsulfanyl]pyrrolidine-2-carboxylate (PubChem CID 87879504) has the molecular formula C17H23NO3S3 and a molecular weight of 385.58 g/mol. Its IUPAC name is [(2S)-2-methyl-3-sulfanylpropanoyl] (2S)-2-[(4-methylsulfanylphenyl)methylsulfanyl]pyrrolidine-2-carboxylate.
| Compound Name | [(2S)-2-methyl-3-sulfanylpropanoyl] (2S)-2-[(4-methylsulfanylphenyl)methylsulfanyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 87879504 |
| Molecular Formula | C17H23NO3S3 |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | [(2S)-2-methyl-3-sulfanylpropanoyl] (2S)-2-[(4-methylsulfanylphenyl)methylsulfanyl]pyrrolidine-2-carboxylate |
| SMILES | CSc1ccc(CS[C@]2(C(=O)OC(=O)[C@H](C)CS)CCCN2)cc1 |
| InChI | InChI=1S/C17H23NO3S3/c1-12(10-22)15(19)21-16(20)17(8-3-9-18-17)24-11-13-4-6-14(23-2)7-5-13/h4-7,12,18,22H,3,8-11H2,1-2H3/t12-,17+/m1/s1 |
| InChIKey | KHVNOJDEXXUXHX-PXAZEXFGSA-N |
| XLogP | 3.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|