About [(2-hydroxyacetyl)amino] dihydrogen phosphite
[(2-hydroxyacetyl)amino] dihydrogen phosphite (PubChem CID 87880972) has the molecular formula C2H6NO5P
and a molecular weight of 155.05 g/mol. Its IUPAC name is [(2-hydroxyacetyl)amino] dihydrogen phosphite.
Molecular Properties
| Compound Name | [(2-hydroxyacetyl)amino] dihydrogen phosphite |
| PubChem CID | 87880972 |
| Molecular Formula | C2H6NO5P |
| Molecular Weight | 155.05 g/mol |
| Exact Mass | 155.00 |
| IUPAC Name | [(2-hydroxyacetyl)amino] dihydrogen phosphite |
| SMILES | O=C(CO)NOP(O)O |
| InChI | InChI=1S/C2H6NO5P/c4-1-2(5)3-8-9(6)7/h4,6-7H,1H2,(H,3,5) |
| InChIKey | LJYAWRIMVKZHBL-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.05 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2-hydroxyacetyl)amino] dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-hydroxyacetyl)amino] dihydrogen phosphite?
The IUPAC name of [(2-hydroxyacetyl)amino] dihydrogen phosphite (CID 87880972) is [(2-hydroxyacetyl)amino] dihydrogen phosphite.
What is the SMILES notation for [(2-hydroxyacetyl)amino] dihydrogen phosphite?
The canonical SMILES for [(2-hydroxyacetyl)amino] dihydrogen phosphite is O=C(CO)NOP(O)O.
What is the InChIKey of [(2-hydroxyacetyl)amino] dihydrogen phosphite?
The InChIKey is LJYAWRIMVKZHBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6NO5P/c4-1-2(5)3-8-9(6)7/h4,6-7H,1H2,(H,3,5).
What are the key properties of [(2-hydroxyacetyl)amino] dihydrogen phosphite?
[(2-hydroxyacetyl)amino] dihydrogen phosphite has a molecular weight of 155.05 g/mol, XLogP of -1.76, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-hydroxyacetyl)amino] dihydrogen phosphite is sourced from PubChem (CID 87880972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).