About carbonic acid;carbonoperoxoic acid
carbonic acid;carbonoperoxoic acid (PubChem CID 87881933) has the molecular formula C3H6O10
and a molecular weight of 202.07 g/mol. Its IUPAC name is carbonic acid;carbonoperoxoic acid.
Molecular Properties
| Compound Name | carbonic acid;carbonoperoxoic acid |
| PubChem CID | 87881933 |
| Molecular Formula | C3H6O10 |
| Molecular Weight | 202.07 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | carbonic acid;carbonoperoxoic acid |
| SMILES | O=C(O)O.O=C(O)O.O=C(O)OO |
| InChI | InChI=1S/CH2O4.2CH2O3/c2-1(3)5-4;2*2-1(3)4/h4H,(H,2,3);2*(H2,2,3,4) |
| InChIKey | NUBAWZYNMAWVKM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 202.07 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;carbonoperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;carbonoperoxoic acid?
The IUPAC name of carbonic acid;carbonoperoxoic acid (CID 87881933) is carbonic acid;carbonoperoxoic acid.
What is the SMILES notation for carbonic acid;carbonoperoxoic acid?
The canonical SMILES for carbonic acid;carbonoperoxoic acid is O=C(O)O.O=C(O)O.O=C(O)OO.
What is the InChIKey of carbonic acid;carbonoperoxoic acid?
The InChIKey is NUBAWZYNMAWVKM-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O4.2CH2O3/c2-1(3)5-4;2*2-1(3)4/h4H,(H,2,3);2*(H2,2,3,4).
What are the key properties of carbonic acid;carbonoperoxoic acid?
carbonic acid;carbonoperoxoic acid has a molecular weight of 202.07 g/mol, XLogP of 0.60, 0 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;carbonoperoxoic acid is sourced from PubChem (CID 87881933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).