carbonic acid;carbonoperoxoic acid

C3H6O10 — CID 87881933

IUPACcarbonic acid;carbonoperoxoic acid
SMILESO=C(O)O.O=C(O)O.O=C(O)OO
InChIInChI=1S/CH2O4.2CH2O3/c2-1(3)5-4;2*2-1(3)4/h4H,(H,2,3);2*(H2,2,3,4)
InChIKeyNUBAWZYNMAWVKM-UHFFFAOYSA-N
MW202.07 g/mol
LogP0.60
Rot. Bonds

About carbonic acid;carbonoperoxoic acid

carbonic acid;carbonoperoxoic acid (PubChem CID 87881933) has the molecular formula C3H6O10 and a molecular weight of 202.07 g/mol. Its IUPAC name is carbonic acid;carbonoperoxoic acid.

Molecular Properties

Compound Namecarbonic acid;carbonoperoxoic acid
PubChem CID87881933
Molecular FormulaC3H6O10
Molecular Weight202.07 g/mol
Exact Mass202.00
IUPAC Namecarbonic acid;carbonoperoxoic acid
SMILESO=C(O)O.O=C(O)O.O=C(O)OO
InChIInChI=1S/CH2O4.2CH2O3/c2-1(3)5-4;2*2-1(3)4/h4H,(H,2,3);2*(H2,2,3,4)
InChIKeyNUBAWZYNMAWVKM-UHFFFAOYSA-N
XLogP0.60
TPSA181.82 Ų
H-Bond Donors6
H-Bond Acceptors5
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500202.07
LogP ≤ 50.60
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze carbonic acid;carbonoperoxoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbonic acid;carbonoperoxoic acid?
The IUPAC name of carbonic acid;carbonoperoxoic acid (CID 87881933) is carbonic acid;carbonoperoxoic acid.
What is the SMILES notation for carbonic acid;carbonoperoxoic acid?
The canonical SMILES for carbonic acid;carbonoperoxoic acid is O=C(O)O.O=C(O)O.O=C(O)OO.
What is the InChIKey of carbonic acid;carbonoperoxoic acid?
The InChIKey is NUBAWZYNMAWVKM-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O4.2CH2O3/c2-1(3)5-4;2*2-1(3)4/h4H,(H,2,3);2*(H2,2,3,4).
What are the key properties of carbonic acid;carbonoperoxoic acid?
carbonic acid;carbonoperoxoic acid has a molecular weight of 202.07 g/mol, XLogP of 0.60, 0 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;carbonoperoxoic acid is sourced from PubChem (CID 87881933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).